C15H22O2 — CID 155012143
(1-methylcyclopentyl) 2-(1-bicyclo[2.2.1]hept-2-enyl)acetate (PubChem CID 155012143) has the molecular formula C15H22O2 and a molecular weight of 234.34 g/mol. Its IUPAC name is (1-methylcyclopentyl) 2-(1-bicyclo[2.2.1]hept-2-enyl)acetate.
| Compound Name | (1-methylcyclopentyl) 2-(1-bicyclo[2.2.1]hept-2-enyl)acetate |
|---|---|
| PubChem CID | 155012143 |
| Molecular Formula | C15H22O2 |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.16 |
| IUPAC Name | (1-methylcyclopentyl) 2-(1-bicyclo[2.2.1]hept-2-enyl)acetate |
| SMILES | CC1(OC(=O)CC23C=CC(CC2)C3)CCCC1 |
| InChI | InChI=1S/C15H22O2/c1-14(6-2-3-7-14)17-13(16)11-15-8-4-12(10-15)5-9-15/h4,8,12H,2-3,5-7,9-11H2,1H3 |
| InChIKey | KUSDHXSSCBACBQ-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|