C24H20N2O4S2 — CID 155013132
(2R)-2-[2-(3-methylphenyl)ethynyl-thiophen-2-ylsulfonylamino]-3-(2,4,5,6,7-pentadeuterio-1H-indol-3-yl)propanoic acid (PubChem CID 155013132) has the molecular formula C24H20N2O4S2 and a molecular weight of 469.60 g/mol. Its IUPAC name is (2R)-2-[2-(3-methylphenyl)ethynyl-thiophen-2-ylsulfonylamino]-3-(2,4,5,6,7-pentadeuterio-1H-indol-3-yl)propanoic acid.
| Compound Name | (2R)-2-[2-(3-methylphenyl)ethynyl-thiophen-2-ylsulfonylamino]-3-(2,4,5,6,7-pentadeuterio-1H-indol-3-yl)propanoic acid |
|---|---|
| PubChem CID | 155013132 |
| Molecular Formula | C24H20N2O4S2 |
| Molecular Weight | 469.60 g/mol |
| Exact Mass | 469.12 |
| IUPAC Name | (2R)-2-[2-(3-methylphenyl)ethynyl-thiophen-2-ylsulfonylamino]-3-(2,4,5,6,7-pentadeuterio-1H-indol-3-yl)propanoic acid |
| SMILES | [2H]c1[nH]c2c([2H])c([2H])c([2H])c([2H])c2c1C[C@H](C(=O)O)N(C#Cc1cccc(C)c1)S(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C24H20N2O4S2/c1-17-6-4-7-18(14-17)11-12-26(32(29,30)23-10-5-13-31-23)22(24(27)28)15-19-16-25-21-9-3-2-8-20(19)21/h2-10,13-14,16,22,25H,15H2,1H3,(H,27,28)/t22-/m1/s1/i2D,3D,8D,9D,16D |
| InChIKey | IFKFWRCHAIXHFR-UOKOPVLDSA-N |
| XLogP | 4.23 |
| TPSA | 90.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.60 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|