C26H29ClF2N2O6S — CID 155013703
(2R,4R,5R)-N-[(4-chloro-2,5-difluorophenyl)-(oxetan-3-yl)methyl]-1-[3-(2-hydroxyethylsulfonyl)benzoyl]-4,5-dimethylpyrrolidine-2-carboxamide (PubChem CID 155013703) has the molecular formula C26H29ClF2N2O6S and a molecular weight of 571.04 g/mol. Its IUPAC name is (2R,4R,5R)-N-[(4-chloro-2,5-difluorophenyl)-(oxetan-3-yl)methyl]-1-[3-(2-hydroxyethylsulfonyl)benzoyl]-4,5-dimethylpyrrolidine-2-carboxamide.
| Compound Name | (2R,4R,5R)-N-[(4-chloro-2,5-difluorophenyl)-(oxetan-3-yl)methyl]-1-[3-(2-hydroxyethylsulfonyl)benzoyl]-4,5-dimethylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 155013703 |
| Molecular Formula | C26H29ClF2N2O6S |
| Molecular Weight | 571.04 g/mol |
| Exact Mass | 570.14 |
| IUPAC Name | (2R,4R,5R)-N-[(4-chloro-2,5-difluorophenyl)-(oxetan-3-yl)methyl]-1-[3-(2-hydroxyethylsulfonyl)benzoyl]-4,5-dimethylpyrrolidine-2-carboxamide |
| SMILES | C[C@@H]1C[C@H](C(=O)NC(c2cc(F)c(Cl)cc2F)C2COC2)N(C(=O)c2cccc(S(=O)(=O)CCO)c2)[C@@H]1C |
| InChI | InChI=1S/C26H29ClF2N2O6S/c1-14-8-23(25(33)30-24(17-12-37-13-17)19-10-22(29)20(27)11-21(19)28)31(15(14)2)26(34)16-4-3-5-18(9-16)38(35,36)7-6-32/h3-5,9-11,14-15,17,23-24,32H,6-8,12-13H2,1-2H3,(H,30,33)/t14-,15-,23-,24?/m1/s1 |
| InChIKey | KNOMNUWEKDJOSI-JPBXWXSNSA-N |
| XLogP | 3.13 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.04 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|