About 3,4-dimethyl-1-propan-2-yl-2,5-dihydropyrrole
3,4-dimethyl-1-propan-2-yl-2,5-dihydropyrrole (PubChem CID 155014250) has the molecular formula C9H17N
and a molecular weight of 139.24 g/mol. Its IUPAC name is 3,4-dimethyl-1-propan-2-yl-2,5-dihydropyrrole.
Molecular Properties
| Compound Name | 3,4-dimethyl-1-propan-2-yl-2,5-dihydropyrrole |
| PubChem CID | 155014250 |
| Molecular Formula | C9H17N |
| Molecular Weight | 139.24 g/mol |
| Exact Mass | 139.14 |
| IUPAC Name | 3,4-dimethyl-1-propan-2-yl-2,5-dihydropyrrole |
| SMILES | CC1=C(C)CN(C(C)C)C1 |
| InChI | InChI=1S/C9H17N/c1-7(2)10-5-8(3)9(4)6-10/h7H,5-6H2,1-4H3 |
| InChIKey | PTTRLMAUBCKMDL-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.24 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3,4-dimethyl-1-propan-2-yl-2,5-dihydropyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dimethyl-1-propan-2-yl-2,5-dihydropyrrole?
The IUPAC name of 3,4-dimethyl-1-propan-2-yl-2,5-dihydropyrrole (CID 155014250) is 3,4-dimethyl-1-propan-2-yl-2,5-dihydropyrrole.
What is the SMILES notation for 3,4-dimethyl-1-propan-2-yl-2,5-dihydropyrrole?
The canonical SMILES for 3,4-dimethyl-1-propan-2-yl-2,5-dihydropyrrole is CC1=C(C)CN(C(C)C)C1.
What is the InChIKey of 3,4-dimethyl-1-propan-2-yl-2,5-dihydropyrrole?
The InChIKey is PTTRLMAUBCKMDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17N/c1-7(2)10-5-8(3)9(4)6-10/h7H,5-6H2,1-4H3.
What are the key properties of 3,4-dimethyl-1-propan-2-yl-2,5-dihydropyrrole?
3,4-dimethyl-1-propan-2-yl-2,5-dihydropyrrole has a molecular weight of 139.24 g/mol, XLogP of 2.05, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dimethyl-1-propan-2-yl-2,5-dihydropyrrole is sourced from PubChem (CID 155014250), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).