C15H24O — CID 155014358
1,4,5,5,8,8-hexamethyl-3,4-dihydro-1H-isochromene (PubChem CID 155014358) has the molecular formula C15H24O and a molecular weight of 220.36 g/mol. Its IUPAC name is 1,4,5,5,8,8-hexamethyl-3,4-dihydro-1H-isochromene.
| Compound Name | 1,4,5,5,8,8-hexamethyl-3,4-dihydro-1H-isochromene |
|---|---|
| PubChem CID | 155014358 |
| Molecular Formula | C15H24O |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.18 |
| IUPAC Name | 1,4,5,5,8,8-hexamethyl-3,4-dihydro-1H-isochromene |
| SMILES | CC1COC(C)C2=C1C(C)(C)C=CC2(C)C |
| InChI | InChI=1S/C15H24O/c1-10-9-16-11(2)13-12(10)14(3,4)7-8-15(13,5)6/h7-8,10-11H,9H2,1-6H3 |
| InChIKey | PPTCPQPASLGWFV-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|