C19H36N4 — CID 155014926
(6E,8Z)-7-(aminomethyl)-2-ethyl-4-methyl-8-[1-(propan-2-ylideneamino)ethylidene]deca-6,9-diene-1,9-diamine (PubChem CID 155014926) has the molecular formula C19H36N4 and a molecular weight of 320.53 g/mol. Its IUPAC name is (6E,8Z)-7-(aminomethyl)-2-ethyl-4-methyl-8-[1-(propan-2-ylideneamino)ethylidene]deca-6,9-diene-1,9-diamine.
| Compound Name | (6E,8Z)-7-(aminomethyl)-2-ethyl-4-methyl-8-[1-(propan-2-ylideneamino)ethylidene]deca-6,9-diene-1,9-diamine |
|---|---|
| PubChem CID | 155014926 |
| Molecular Formula | C19H36N4 |
| Molecular Weight | 320.53 g/mol |
| Exact Mass | 320.29 |
| IUPAC Name | (6E,8Z)-7-(aminomethyl)-2-ethyl-4-methyl-8-[1-(propan-2-ylideneamino)ethylidene]deca-6,9-diene-1,9-diamine |
| SMILES | C=C(N)C(=C(/C)N=C(C)C)/C(=C\CC(C)CC(CC)CN)CN |
| InChI | InChI=1S/C19H36N4/c1-7-17(11-20)10-14(4)8-9-18(12-21)19(15(5)22)16(6)23-13(2)3/h9,14,17H,5,7-8,10-12,20-22H2,1-4,6H3/b18-9-,19-16+ |
| InChIKey | QIQOMNWCGDGMRV-IBHFBHHQSA-N |
| XLogP | 3.50 |
| TPSA | 90.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.53 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|