C28H23NO — CID 155015317
4-[9-(4-ethenylphenyl)-8-methyl-7,8-dihydrocarbazol-3-yl]benzaldehyde (PubChem CID 155015317) has the molecular formula C28H23NO and a molecular weight of 389.50 g/mol. Its IUPAC name is 4-[9-(4-ethenylphenyl)-8-methyl-7,8-dihydrocarbazol-3-yl]benzaldehyde.
| Compound Name | 4-[9-(4-ethenylphenyl)-8-methyl-7,8-dihydrocarbazol-3-yl]benzaldehyde |
|---|---|
| PubChem CID | 155015317 |
| Molecular Formula | C28H23NO |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.18 |
| IUPAC Name | 4-[9-(4-ethenylphenyl)-8-methyl-7,8-dihydrocarbazol-3-yl]benzaldehyde |
| SMILES | C=Cc1ccc(-n2c3c(c4cc(-c5ccc(C=O)cc5)ccc42)C=CCC3C)cc1 |
| InChI | InChI=1S/C28H23NO/c1-3-20-9-14-24(15-10-20)29-27-16-13-23(22-11-7-21(18-30)8-12-22)17-26(27)25-6-4-5-19(2)28(25)29/h3-4,6-19H,1,5H2,2H3 |
| InChIKey | FDTXQPAOWMOZKW-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|