C22H38FN — CID 155015797
(6Z)-3-(2-cyclopentylethyl)-N-ethenyl-7-ethyl-4-(fluoromethyl)-4-methylnona-6,8-dien-1-amine (PubChem CID 155015797) has the molecular formula C22H38FN and a molecular weight of 335.55 g/mol. Its IUPAC name is (6Z)-3-(2-cyclopentylethyl)-N-ethenyl-7-ethyl-4-(fluoromethyl)-4-methylnona-6,8-dien-1-amine.
| Compound Name | (6Z)-3-(2-cyclopentylethyl)-N-ethenyl-7-ethyl-4-(fluoromethyl)-4-methylnona-6,8-dien-1-amine |
|---|---|
| PubChem CID | 155015797 |
| Molecular Formula | C22H38FN |
| Molecular Weight | 335.55 g/mol |
| Exact Mass | 335.30 |
| IUPAC Name | (6Z)-3-(2-cyclopentylethyl)-N-ethenyl-7-ethyl-4-(fluoromethyl)-4-methylnona-6,8-dien-1-amine |
| SMILES | C=CNCCC(CCC1CCCC1)C(C)(CF)C/C=C(\C=C)CC |
| InChI | InChI=1S/C22H38FN/c1-5-19(6-2)14-16-22(4,18-23)21(15-17-24-7-3)13-12-20-10-8-9-11-20/h5,7,14,20-21,24H,1,3,6,8-13,15-18H2,2,4H3/b19-14+ |
| InChIKey | GYRZRIMVBACSGV-XMHGGMMESA-N |
| XLogP | 6.58 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.55 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|