C24H19F2N3O4S — CID 155015839
(3R)-2-[(6S)-1,2-difluoro-5,6-dihydrobenzo[b][1]benzothiepin-6-yl]-11-hydroxy-5-oxa-1,2,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-diene-9,12-dione (PubChem CID 155015839) has the molecular formula C24H19F2N3O4S and a molecular weight of 483.50 g/mol. Its IUPAC name is (3R)-2-[(6S)-1,2-difluoro-5,6-dihydrobenzo[b][1]benzothiepin-6-yl]-11-hydroxy-5-oxa-1,2,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-diene-9,12-dione.
| Compound Name | (3R)-2-[(6S)-1,2-difluoro-5,6-dihydrobenzo[b][1]benzothiepin-6-yl]-11-hydroxy-5-oxa-1,2,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-diene-9,12-dione |
|---|---|
| PubChem CID | 155015839 |
| Molecular Formula | C24H19F2N3O4S |
| Molecular Weight | 483.50 g/mol |
| Exact Mass | 483.11 |
| IUPAC Name | (3R)-2-[(6S)-1,2-difluoro-5,6-dihydrobenzo[b][1]benzothiepin-6-yl]-11-hydroxy-5-oxa-1,2,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-diene-9,12-dione |
| SMILES | O=C1c2c(O)c(=O)ccn2N([C@H]2Cc3ccc(F)c(F)c3Sc3ccccc32)[C@@H]2COCCN12 |
| InChI | InChI=1S/C24H19F2N3O4S/c25-15-6-5-13-11-16(14-3-1-2-4-18(14)34-23(13)20(15)26)29-19-12-33-10-9-27(19)24(32)21-22(31)17(30)7-8-28(21)29/h1-8,16,19,31H,9-12H2/t16-,19+/m0/s1 |
| InChIKey | DJTVJXCLKZDFBM-QFBILLFUSA-N |
| XLogP | 3.03 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.50 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |