C26H20F2N4O4 — CID 155015951
(3R)-2-[(11S)-7,8-difluoro-6,11-dihydroindolo[1,2-b]isoquinolin-11-yl]-11-hydroxy-5-oxa-1,2,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-diene-9,12-dione (PubChem CID 155015951) has the molecular formula C26H20F2N4O4 and a molecular weight of 490.47 g/mol. Its IUPAC name is (3R)-2-[(11S)-7,8-difluoro-6,11-dihydroindolo[1,2-b]isoquinolin-11-yl]-11-hydroxy-5-oxa-1,2,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-diene-9,12-dione.
| Compound Name | (3R)-2-[(11S)-7,8-difluoro-6,11-dihydroindolo[1,2-b]isoquinolin-11-yl]-11-hydroxy-5-oxa-1,2,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-diene-9,12-dione |
|---|---|
| PubChem CID | 155015951 |
| Molecular Formula | C26H20F2N4O4 |
| Molecular Weight | 490.47 g/mol |
| Exact Mass | 490.15 |
| IUPAC Name | (3R)-2-[(11S)-7,8-difluoro-6,11-dihydroindolo[1,2-b]isoquinolin-11-yl]-11-hydroxy-5-oxa-1,2,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-diene-9,12-dione |
| SMILES | O=C1c2c(O)c(=O)ccn2N([C@H]2c3ccc(F)c(F)c3Cn3c2cc2ccccc23)[C@@H]2COCCN12 |
| InChI | InChI=1S/C26H20F2N4O4/c27-17-6-5-15-16(22(17)28)12-30-18-4-2-1-3-14(18)11-19(30)23(15)32-21-13-36-10-9-29(21)26(35)24-25(34)20(33)7-8-31(24)32/h1-8,11,21,23,34H,9-10,12-13H2/t21-,23+/m1/s1 |
| InChIKey | IOWPUNKSXCGUKQ-GGAORHGYSA-N |
| XLogP | 2.69 |
| TPSA | 79.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.47 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |