C16H20ClN — CID 155017012
2-chloro-3,6-dimethyl-N-[(3E,5Z)-2-methylhepta-1,3,5-trien-3-yl]aniline (PubChem CID 155017012) has the molecular formula C16H20ClN and a molecular weight of 261.80 g/mol. Its IUPAC name is 2-chloro-3,6-dimethyl-N-[(3E,5Z)-2-methylhepta-1,3,5-trien-3-yl]aniline.
| Compound Name | 2-chloro-3,6-dimethyl-N-[(3E,5Z)-2-methylhepta-1,3,5-trien-3-yl]aniline |
|---|---|
| PubChem CID | 155017012 |
| Molecular Formula | C16H20ClN |
| Molecular Weight | 261.80 g/mol |
| Exact Mass | 261.13 |
| IUPAC Name | 2-chloro-3,6-dimethyl-N-[(3E,5Z)-2-methylhepta-1,3,5-trien-3-yl]aniline |
| SMILES | C=C(C)/C(=C\C=C/C)Nc1c(C)ccc(C)c1Cl |
| InChI | InChI=1S/C16H20ClN/c1-6-7-8-14(11(2)3)18-16-13(5)10-9-12(4)15(16)17/h6-10,18H,2H2,1,3-5H3/b7-6-,14-8+ |
| InChIKey | CSEPBRXJJTXQSC-BHWOWGIZSA-N |
| XLogP | 5.40 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.80 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|