C25H33N5O2 — CID 155017147
tert-butyl 2-[(3S)-1-ethanimidoyl-5-(4-ethylphenyl)-2-imino-6,7-dimethyl-3,8-dihydropyrrolo[2,3-e][1,4]diazepin-3-yl]acetate (PubChem CID 155017147) has the molecular formula C25H33N5O2 and a molecular weight of 435.57 g/mol. Its IUPAC name is tert-butyl 2-[(3S)-1-ethanimidoyl-5-(4-ethylphenyl)-2-imino-6,7-dimethyl-3,8-dihydropyrrolo[2,3-e][1,4]diazepin-3-yl]acetate.
| Compound Name | tert-butyl 2-[(3S)-1-ethanimidoyl-5-(4-ethylphenyl)-2-imino-6,7-dimethyl-3,8-dihydropyrrolo[2,3-e][1,4]diazepin-3-yl]acetate |
|---|---|
| PubChem CID | 155017147 |
| Molecular Formula | C25H33N5O2 |
| Molecular Weight | 435.57 g/mol |
| Exact Mass | 435.26 |
| IUPAC Name | tert-butyl 2-[(3S)-1-ethanimidoyl-5-(4-ethylphenyl)-2-imino-6,7-dimethyl-3,8-dihydropyrrolo[2,3-e][1,4]diazepin-3-yl]acetate |
| SMILES | [H]/N=C(\C)N1/C(=N/[H])[C@H](CC(=O)OC(C)(C)C)N=C(c2ccc(CC)cc2)c2c1[nH]c(C)c2C |
| InChI | InChI=1S/C25H33N5O2/c1-8-17-9-11-18(12-10-17)22-21-14(2)15(3)28-24(21)30(16(4)26)23(27)19(29-22)13-20(31)32-25(5,6)7/h9-12,19,26-28H,8,13H2,1-7H3/b26-16+,27-23+/t19-/m0/s1 |
| InChIKey | SXCFFXRRSJDEIL-QYSDYEQUSA-N |
| XLogP | 4.93 |
| TPSA | 105.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.57 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|