About N-[(3S)-1,4-dioxopentan-3-yl]propanamide
N-[(3S)-1,4-dioxopentan-3-yl]propanamide (PubChem CID 155017240) has the molecular formula C8H13NO3
and a molecular weight of 171.20 g/mol. Its IUPAC name is N-[(3S)-1,4-dioxopentan-3-yl]propanamide.
Molecular Properties
| Compound Name | N-[(3S)-1,4-dioxopentan-3-yl]propanamide |
| PubChem CID | 155017240 |
| Molecular Formula | C8H13NO3 |
| Molecular Weight | 171.20 g/mol |
| Exact Mass | 171.09 |
| IUPAC Name | N-[(3S)-1,4-dioxopentan-3-yl]propanamide |
| SMILES | CCC(=O)N[C@@H](CC=O)C(C)=O |
| InChI | InChI=1S/C8H13NO3/c1-3-8(12)9-7(4-5-10)6(2)11/h5,7H,3-4H2,1-2H3,(H,9,12)/t7-/m0/s1 |
| InChIKey | FSHMZGVQKMCCRG-ZETCQYMHSA-N |
| XLogP | 0.06 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.20 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze N-[(3S)-1,4-dioxopentan-3-yl]propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3S)-1,4-dioxopentan-3-yl]propanamide?
The IUPAC name of N-[(3S)-1,4-dioxopentan-3-yl]propanamide (CID 155017240) is N-[(3S)-1,4-dioxopentan-3-yl]propanamide.
What is the SMILES notation for N-[(3S)-1,4-dioxopentan-3-yl]propanamide?
The canonical SMILES for N-[(3S)-1,4-dioxopentan-3-yl]propanamide is CCC(=O)N[C@@H](CC=O)C(C)=O.
What is the InChIKey of N-[(3S)-1,4-dioxopentan-3-yl]propanamide?
The InChIKey is FSHMZGVQKMCCRG-ZETCQYMHSA-N. The full InChI is InChI=1S/C8H13NO3/c1-3-8(12)9-7(4-5-10)6(2)11/h5,7H,3-4H2,1-2H3,(H,9,12)/t7-/m0/s1.
What are the key properties of N-[(3S)-1,4-dioxopentan-3-yl]propanamide?
N-[(3S)-1,4-dioxopentan-3-yl]propanamide has a molecular weight of 171.20 g/mol, XLogP of 0.06, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3S)-1,4-dioxopentan-3-yl]propanamide is sourced from PubChem (CID 155017240), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).