C19H14N2O3S2 — CID 155017798
methyl 5-[(5-amino-1-benzothiophene-2-carbonyl)amino]-1-benzothiophene-2-carboxylate (PubChem CID 155017798) has the molecular formula C19H14N2O3S2 and a molecular weight of 382.47 g/mol. Its IUPAC name is methyl 5-[(5-amino-1-benzothiophene-2-carbonyl)amino]-1-benzothiophene-2-carboxylate.
| Compound Name | methyl 5-[(5-amino-1-benzothiophene-2-carbonyl)amino]-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 155017798 |
| Molecular Formula | C19H14N2O3S2 |
| Molecular Weight | 382.47 g/mol |
| Exact Mass | 382.04 |
| IUPAC Name | methyl 5-[(5-amino-1-benzothiophene-2-carbonyl)amino]-1-benzothiophene-2-carboxylate |
| SMILES | COC(=O)c1cc2cc(NC(=O)c3cc4cc(N)ccc4s3)ccc2s1 |
| InChI | InChI=1S/C19H14N2O3S2/c1-24-19(23)17-9-11-7-13(3-5-15(11)26-17)21-18(22)16-8-10-6-12(20)2-4-14(10)25-16/h2-9H,20H2,1H3,(H,21,22) |
| InChIKey | GNUVXPAXZJFTHZ-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.47 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|