C8H13N3O — CID 155017924
3-(cyclopentylmethyl)-1,4-dihydro-1,2,4-triazol-5-one (PubChem CID 155017924) has the molecular formula C8H13N3O and a molecular weight of 167.21 g/mol. Its IUPAC name is 3-(cyclopentylmethyl)-1,4-dihydro-1,2,4-triazol-5-one.
| Compound Name | 3-(cyclopentylmethyl)-1,4-dihydro-1,2,4-triazol-5-one |
|---|---|
| PubChem CID | 155017924 |
| Molecular Formula | C8H13N3O |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.11 |
| IUPAC Name | 3-(cyclopentylmethyl)-1,4-dihydro-1,2,4-triazol-5-one |
| SMILES | O=c1[nH]nc(CC2CCCC2)[nH]1 |
| InChI | InChI=1S/C8H13N3O/c12-8-9-7(10-11-8)5-6-3-1-2-4-6/h6H,1-5H2,(H2,9,10,11,12) |
| InChIKey | SYWLYWCBZZFJGJ-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 61.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |