C26H29F9N2O4 — CID 155018004
1,1,1,3,3,3-hexafluoropropan-2-yl 1-[[2-(4,4-dihydroxy-3,3-dimethylbut-1-ynyl)-4-(trifluoromethyl)phenyl]methyl]-1,8-diazaspiro[4.5]decane-8-carboxylate (PubChem CID 155018004) has the molecular formula C26H29F9N2O4 and a molecular weight of 604.51 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoropropan-2-yl 1-[[2-(4,4-dihydroxy-3,3-dimethylbut-1-ynyl)-4-(trifluoromethyl)phenyl]methyl]-1,8-diazaspiro[4.5]decane-8-carboxylate.
| Compound Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 1-[[2-(4,4-dihydroxy-3,3-dimethylbut-1-ynyl)-4-(trifluoromethyl)phenyl]methyl]-1,8-diazaspiro[4.5]decane-8-carboxylate |
|---|---|
| PubChem CID | 155018004 |
| Molecular Formula | C26H29F9N2O4 |
| Molecular Weight | 604.51 g/mol |
| Exact Mass | 604.20 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 1-[[2-(4,4-dihydroxy-3,3-dimethylbut-1-ynyl)-4-(trifluoromethyl)phenyl]methyl]-1,8-diazaspiro[4.5]decane-8-carboxylate |
| SMILES | CC(C)(C#Cc1cc(C(F)(F)F)ccc1CN1CCCC12CCN(C(=O)OC(C(F)(F)F)C(F)(F)F)CC2)C(O)O |
| InChI | InChI=1S/C26H29F9N2O4/c1-22(2,20(38)39)8-6-16-14-18(24(27,28)29)5-4-17(16)15-37-11-3-7-23(37)9-12-36(13-10-23)21(40)41-19(25(30,31)32)26(33,34)35/h4-5,14,19-20,38-39H,3,7,9-13,15H2,1-2H3 |
| InChIKey | ZUDWMZUUKLSCGI-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 73.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.51 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|