C23H30F3N3O3S — CID 155019520
N-[2-(6,6-dimethyl-1,1-dioxothian-3-yl)ethyl]-N-[(2E,4Z)-2-ethenylhepta-2,4,6-trienyl]-5-(trifluoromethyl)-1H-pyrazole-3-carboxamide (PubChem CID 155019520) has the molecular formula C23H30F3N3O3S and a molecular weight of 485.57 g/mol. Its IUPAC name is N-[2-(6,6-dimethyl-1,1-dioxothian-3-yl)ethyl]-N-[(2E,4Z)-2-ethenylhepta-2,4,6-trienyl]-5-(trifluoromethyl)-1H-pyrazole-3-carboxamide.
| Compound Name | N-[2-(6,6-dimethyl-1,1-dioxothian-3-yl)ethyl]-N-[(2E,4Z)-2-ethenylhepta-2,4,6-trienyl]-5-(trifluoromethyl)-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 155019520 |
| Molecular Formula | C23H30F3N3O3S |
| Molecular Weight | 485.57 g/mol |
| Exact Mass | 485.20 |
| IUPAC Name | N-[2-(6,6-dimethyl-1,1-dioxothian-3-yl)ethyl]-N-[(2E,4Z)-2-ethenylhepta-2,4,6-trienyl]-5-(trifluoromethyl)-1H-pyrazole-3-carboxamide |
| SMILES | C=C/C=C\C=C(/C=C)CN(CCC1CCC(C)(C)S(=O)(=O)C1)C(=O)c1cc(C(F)(F)F)[nH]n1 |
| InChI | InChI=1S/C23H30F3N3O3S/c1-5-7-8-9-17(6-2)15-29(21(30)19-14-20(28-27-19)23(24,25)26)13-11-18-10-12-22(3,4)33(31,32)16-18/h5-9,14,18H,1-2,10-13,15-16H2,3-4H3,(H,27,28)/b8-7-,17-9+ |
| InChIKey | FPDGGHLZTOUWHW-BNWIPASCSA-N |
| XLogP | 4.72 |
| TPSA | 83.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.57 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|