C20H27N3O3 — CID 155019573
(2E)-2-[[2-[(1S)-1-hydroxyethyl]-5-methyl-4-pyridinyl]-(4-methoxy-4-methylpiperidin-1-yl)methylidene]-3-oxobutanenitrile (PubChem CID 155019573) has the molecular formula C20H27N3O3 and a molecular weight of 357.45 g/mol. Its IUPAC name is (2E)-2-[[2-[(1S)-1-hydroxyethyl]-5-methyl-4-pyridinyl]-(4-methoxy-4-methylpiperidin-1-yl)methylidene]-3-oxobutanenitrile.
| Compound Name | (2E)-2-[[2-[(1S)-1-hydroxyethyl]-5-methyl-4-pyridinyl]-(4-methoxy-4-methylpiperidin-1-yl)methylidene]-3-oxobutanenitrile |
|---|---|
| PubChem CID | 155019573 |
| Molecular Formula | C20H27N3O3 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.21 |
| IUPAC Name | (2E)-2-[[2-[(1S)-1-hydroxyethyl]-5-methyl-4-pyridinyl]-(4-methoxy-4-methylpiperidin-1-yl)methylidene]-3-oxobutanenitrile |
| SMILES | COC1(C)CCN(/C(=C(\C#N)C(C)=O)c2cc([C@H](C)O)ncc2C)CC1 |
| InChI | InChI=1S/C20H27N3O3/c1-13-12-22-18(15(3)25)10-16(13)19(17(11-21)14(2)24)23-8-6-20(4,26-5)7-9-23/h10,12,15,25H,6-9H2,1-5H3/b19-17+/t15-/m0/s1 |
| InChIKey | SKGGSTHTWLORSX-UHHPSXQGSA-N |
| XLogP | 2.77 |
| TPSA | 86.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|