About iodo-[(3-methyl-5,6-dihydro-4H-pyrrolo[2,1-e]pyrazol-2-yl)methoxy]phosphane
iodo-[(3-methyl-5,6-dihydro-4H-pyrrolo[2,1-e]pyrazol-2-yl)methoxy]phosphane (PubChem CID 155019605) has the molecular formula C8H12IN2OP
and a molecular weight of 310.08 g/mol. Its IUPAC name is iodo-[(3-methyl-5,6-dihydro-4H-pyrrolo[2,1-e]pyrazol-2-yl)methoxy]phosphane.
Molecular Properties
| Compound Name | iodo-[(3-methyl-5,6-dihydro-4H-pyrrolo[2,1-e]pyrazol-2-yl)methoxy]phosphane |
| PubChem CID | 155019605 |
| Molecular Formula | C8H12IN2OP |
| Molecular Weight | 310.08 g/mol |
| Exact Mass | 309.97 |
| IUPAC Name | iodo-[(3-methyl-5,6-dihydro-4H-pyrrolo[2,1-e]pyrazol-2-yl)methoxy]phosphane |
| SMILES | Cc1c(COPI)nn2c1CCC2 |
| InChI | InChI=1S/C8H12IN2OP/c1-6-7(5-12-13-9)10-11-4-2-3-8(6)11/h13H,2-5H2,1H3 |
| InChIKey | HMJKRXBHQKYGFS-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.08 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze iodo-[(3-methyl-5,6-dihydro-4H-pyrrolo[2,1-e]pyrazol-2-yl)methoxy]phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of iodo-[(3-methyl-5,6-dihydro-4H-pyrrolo[2,1-e]pyrazol-2-yl)methoxy]phosphane?
The IUPAC name of iodo-[(3-methyl-5,6-dihydro-4H-pyrrolo[2,1-e]pyrazol-2-yl)methoxy]phosphane (CID 155019605) is iodo-[(3-methyl-5,6-dihydro-4H-pyrrolo[2,1-e]pyrazol-2-yl)methoxy]phosphane.
What is the SMILES notation for iodo-[(3-methyl-5,6-dihydro-4H-pyrrolo[2,1-e]pyrazol-2-yl)methoxy]phosphane?
The canonical SMILES for iodo-[(3-methyl-5,6-dihydro-4H-pyrrolo[2,1-e]pyrazol-2-yl)methoxy]phosphane is Cc1c(COPI)nn2c1CCC2.
What is the InChIKey of iodo-[(3-methyl-5,6-dihydro-4H-pyrrolo[2,1-e]pyrazol-2-yl)methoxy]phosphane?
The InChIKey is HMJKRXBHQKYGFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12IN2OP/c1-6-7(5-12-13-9)10-11-4-2-3-8(6)11/h13H,2-5H2,1H3.
What are the key properties of iodo-[(3-methyl-5,6-dihydro-4H-pyrrolo[2,1-e]pyrazol-2-yl)methoxy]phosphane?
iodo-[(3-methyl-5,6-dihydro-4H-pyrrolo[2,1-e]pyrazol-2-yl)methoxy]phosphane has a molecular weight of 310.08 g/mol, XLogP of 2.60, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for iodo-[(3-methyl-5,6-dihydro-4H-pyrrolo[2,1-e]pyrazol-2-yl)methoxy]phosphane is sourced from PubChem (CID 155019605), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).