C9H14IN2OP — CID 155019652
iodo-[(3-methyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-2-yl)methoxy]phosphane (PubChem CID 155019652) has the molecular formula C9H14IN2OP and a molecular weight of 324.10 g/mol. Its IUPAC name is iodo-[(3-methyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-2-yl)methoxy]phosphane.
| Compound Name | iodo-[(3-methyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-2-yl)methoxy]phosphane |
|---|---|
| PubChem CID | 155019652 |
| Molecular Formula | C9H14IN2OP |
| Molecular Weight | 324.10 g/mol |
| Exact Mass | 323.99 |
| IUPAC Name | iodo-[(3-methyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-2-yl)methoxy]phosphane |
| SMILES | Cc1c(COPI)nn2c1CCCC2 |
| InChI | InChI=1S/C9H14IN2OP/c1-7-8(6-13-14-10)11-12-5-3-2-4-9(7)12/h14H,2-6H2,1H3 |
| InChIKey | JMGBFVXYIOGSAN-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.10 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|