About [1-[4-[2-[[(2R)-1,4-dimethylpiperazin-2-yl]methoxy]ethyl]piperazin-1-yl]cyclopropyl]methanol
[1-[4-[2-[[(2R)-1,4-dimethylpiperazin-2-yl]methoxy]ethyl]piperazin-1-yl]cyclopropyl]methanol (PubChem CID 155019674) has the molecular formula C17H34N4O2
and a molecular weight of 326.49 g/mol. Its IUPAC name is [1-[4-[2-[[(2R)-1,4-dimethylpiperazin-2-yl]methoxy]ethyl]piperazin-1-yl]cyclopropyl]methanol.
Molecular Properties
| Compound Name | [1-[4-[2-[[(2R)-1,4-dimethylpiperazin-2-yl]methoxy]ethyl]piperazin-1-yl]cyclopropyl]methanol |
| PubChem CID | 155019674 |
| Molecular Formula | C17H34N4O2 |
| Molecular Weight | 326.49 g/mol |
| Exact Mass | 326.27 |
| IUPAC Name | [1-[4-[2-[[(2R)-1,4-dimethylpiperazin-2-yl]methoxy]ethyl]piperazin-1-yl]cyclopropyl]methanol |
| SMILES | CN1CCN(C)[C@@H](COCCN2CCN(C3(CO)CC3)CC2)C1 |
| InChI | InChI=1S/C17H34N4O2/c1-18-5-6-19(2)16(13-18)14-23-12-11-20-7-9-21(10-8-20)17(15-22)3-4-17/h16,22H,3-15H2,1-2H3/t16-/m1/s1 |
| InChIKey | XXHRSZHUPPOYBJ-MRXNPFEDSA-N |
| XLogP | -0.61 |
| TPSA | 42.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.49 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [1-[4-[2-[[(2R)-1,4-dimethylpiperazin-2-yl]methoxy]ethyl]piperazin-1-yl]cyclopropyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[4-[2-[[(2R)-1,4-dimethylpiperazin-2-yl]methoxy]ethyl]piperazin-1-yl]cyclopropyl]methanol?
The IUPAC name of [1-[4-[2-[[(2R)-1,4-dimethylpiperazin-2-yl]methoxy]ethyl]piperazin-1-yl]cyclopropyl]methanol (CID 155019674) is [1-[4-[2-[[(2R)-1,4-dimethylpiperazin-2-yl]methoxy]ethyl]piperazin-1-yl]cyclopropyl]methanol.
What is the SMILES notation for [1-[4-[2-[[(2R)-1,4-dimethylpiperazin-2-yl]methoxy]ethyl]piperazin-1-yl]cyclopropyl]methanol?
The canonical SMILES for [1-[4-[2-[[(2R)-1,4-dimethylpiperazin-2-yl]methoxy]ethyl]piperazin-1-yl]cyclopropyl]methanol is CN1CCN(C)[C@@H](COCCN2CCN(C3(CO)CC3)CC2)C1.
What is the InChIKey of [1-[4-[2-[[(2R)-1,4-dimethylpiperazin-2-yl]methoxy]ethyl]piperazin-1-yl]cyclopropyl]methanol?
The InChIKey is XXHRSZHUPPOYBJ-MRXNPFEDSA-N. The full InChI is InChI=1S/C17H34N4O2/c1-18-5-6-19(2)16(13-18)14-23-12-11-20-7-9-21(10-8-20)17(15-22)3-4-17/h16,22H,3-15H2,1-2H3/t16-/m1/s1.
What are the key properties of [1-[4-[2-[[(2R)-1,4-dimethylpiperazin-2-yl]methoxy]ethyl]piperazin-1-yl]cyclopropyl]methanol?
[1-[4-[2-[[(2R)-1,4-dimethylpiperazin-2-yl]methoxy]ethyl]piperazin-1-yl]cyclopropyl]methanol has a molecular weight of 326.49 g/mol, XLogP of -0.61, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[4-[2-[[(2R)-1,4-dimethylpiperazin-2-yl]methoxy]ethyl]piperazin-1-yl]cyclopropyl]methanol is sourced from PubChem (CID 155019674), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).