About O-[(Z)-3,4-dimethylhex-2-en-2-yl]hydroxylamine
O-[(Z)-3,4-dimethylhex-2-en-2-yl]hydroxylamine (PubChem CID 155019939) has the molecular formula C8H17NO
and a molecular weight of 143.23 g/mol. Its IUPAC name is O-[(Z)-3,4-dimethylhex-2-en-2-yl]hydroxylamine.
Molecular Properties
| Compound Name | O-[(Z)-3,4-dimethylhex-2-en-2-yl]hydroxylamine |
| PubChem CID | 155019939 |
| Molecular Formula | C8H17NO |
| Molecular Weight | 143.23 g/mol |
| Exact Mass | 143.13 |
| IUPAC Name | O-[(Z)-3,4-dimethylhex-2-en-2-yl]hydroxylamine |
| SMILES | CCC(C)/C(C)=C(/C)ON |
| InChI | InChI=1S/C8H17NO/c1-5-6(2)7(3)8(4)10-9/h6H,5,9H2,1-4H3/b8-7- |
| InChIKey | PZFJAVQSQRVTNJ-FPLPWBNLSA-N |
| XLogP | 2.22 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.23 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze O-[(Z)-3,4-dimethylhex-2-en-2-yl]hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-[(Z)-3,4-dimethylhex-2-en-2-yl]hydroxylamine?
The IUPAC name of O-[(Z)-3,4-dimethylhex-2-en-2-yl]hydroxylamine (CID 155019939) is O-[(Z)-3,4-dimethylhex-2-en-2-yl]hydroxylamine.
What is the SMILES notation for O-[(Z)-3,4-dimethylhex-2-en-2-yl]hydroxylamine?
The canonical SMILES for O-[(Z)-3,4-dimethylhex-2-en-2-yl]hydroxylamine is CCC(C)/C(C)=C(/C)ON.
What is the InChIKey of O-[(Z)-3,4-dimethylhex-2-en-2-yl]hydroxylamine?
The InChIKey is PZFJAVQSQRVTNJ-FPLPWBNLSA-N. The full InChI is InChI=1S/C8H17NO/c1-5-6(2)7(3)8(4)10-9/h6H,5,9H2,1-4H3/b8-7-.
What are the key properties of O-[(Z)-3,4-dimethylhex-2-en-2-yl]hydroxylamine?
O-[(Z)-3,4-dimethylhex-2-en-2-yl]hydroxylamine has a molecular weight of 143.23 g/mol, XLogP of 2.22, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for O-[(Z)-3,4-dimethylhex-2-en-2-yl]hydroxylamine is sourced from PubChem (CID 155019939), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).