C46H76N2O6 — CID 155020748
[2-[3-[3,5-ditert-butyl-4-(3-methylpentan-3-yloxy)phenyl]propanoyloxy]hydrazinyl] 3-[3,5-ditert-butyl-4-(3-methylpentan-3-yloxy)phenyl]propanoate (PubChem CID 155020748) has the molecular formula C46H76N2O6 and a molecular weight of 753.12 g/mol. Its IUPAC name is [2-[3-[3,5-ditert-butyl-4-(3-methylpentan-3-yloxy)phenyl]propanoyloxy]hydrazinyl] 3-[3,5-ditert-butyl-4-(3-methylpentan-3-yloxy)phenyl]propanoate.
| Compound Name | [2-[3-[3,5-ditert-butyl-4-(3-methylpentan-3-yloxy)phenyl]propanoyloxy]hydrazinyl] 3-[3,5-ditert-butyl-4-(3-methylpentan-3-yloxy)phenyl]propanoate |
|---|---|
| PubChem CID | 155020748 |
| Molecular Formula | C46H76N2O6 |
| Molecular Weight | 753.12 g/mol |
| Exact Mass | 752.57 |
| IUPAC Name | [2-[3-[3,5-ditert-butyl-4-(3-methylpentan-3-yloxy)phenyl]propanoyloxy]hydrazinyl] 3-[3,5-ditert-butyl-4-(3-methylpentan-3-yloxy)phenyl]propanoate |
| SMILES | CCC(C)(CC)Oc1c(C(C)(C)C)cc(CCC(=O)ONNOC(=O)CCc2cc(C(C)(C)C)c(OC(C)(CC)CC)c(C(C)(C)C)c2)cc1C(C)(C)C |
| InChI | InChI=1S/C46H76N2O6/c1-19-45(17,20-2)51-39-33(41(5,6)7)27-31(28-34(39)42(8,9)10)23-25-37(49)53-47-48-54-38(50)26-24-32-29-35(43(11,12)13)40(36(30-32)44(14,15)16)52-46(18,21-3)22-4/h27-30,47-48H,19-26H2,1-18H3 |
| InChIKey | PKQZIDPXRBGROO-UHFFFAOYSA-N |
| XLogP | 11.37 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 753.12 |
| LogP ≤ 5 | 11.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|