C28H11BF20O — CID 15502117
diethyloxidanium;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide (PubChem CID 15502117) has the molecular formula C28H11BF20O and a molecular weight of 754.17 g/mol. Its IUPAC name is diethyloxidanium;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide.
| Compound Name | diethyloxidanium;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide |
|---|---|
| PubChem CID | 15502117 |
| Molecular Formula | C28H11BF20O |
| Molecular Weight | 754.17 g/mol |
| Exact Mass | 754.06 |
| IUPAC Name | diethyloxidanium;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide |
| SMILES | CC[OH+]CC.Fc1c(F)c(F)c([B-](c2c(F)c(F)c(F)c(F)c2F)(c2c(F)c(F)c(F)c(F)c2F)c2c(F)c(F)c(F)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C24BF20.C4H10O/c26-5-1(6(27)14(35)21(42)13(5)34)25(2-7(28)15(36)22(43)16(37)8(2)29,3-9(30)17(38)23(44)18(39)10(3)31)4-11(32)19(40)24(45)20(41)12(4)33;1-3-5-4-2/h;3-4H2,1-2H3/q-1;/p+1 |
| InChIKey | JWJBSLMWIPWFCR-UHFFFAOYSA-O |
| XLogP | 6.40 |
| TPSA | 12.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 754.17 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|