C15H13ClF2N6 — CID 155021448
8-N-(2-chloro-4,6-difluorophenyl)-2-N-cyclobutyl-7H-purine-2,8-diamine (PubChem CID 155021448) has the molecular formula C15H13ClF2N6 and a molecular weight of 350.76 g/mol. Its IUPAC name is 8-N-(2-chloro-4,6-difluorophenyl)-2-N-cyclobutyl-7H-purine-2,8-diamine.
| Compound Name | 8-N-(2-chloro-4,6-difluorophenyl)-2-N-cyclobutyl-7H-purine-2,8-diamine |
|---|---|
| PubChem CID | 155021448 |
| Molecular Formula | C15H13ClF2N6 |
| Molecular Weight | 350.76 g/mol |
| Exact Mass | 350.09 |
| IUPAC Name | 8-N-(2-chloro-4,6-difluorophenyl)-2-N-cyclobutyl-7H-purine-2,8-diamine |
| SMILES | Fc1cc(F)c(Nc2nc3nc(NC4CCC4)ncc3[nH]2)c(Cl)c1 |
| InChI | InChI=1S/C15H13ClF2N6/c16-9-4-7(17)5-10(18)12(9)22-15-21-11-6-19-14(23-13(11)24-15)20-8-2-1-3-8/h4-6,8H,1-3H2,(H3,19,20,21,22,23,24) |
| InChIKey | HEIJSDRDGPXIHS-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 78.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.76 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |