C18H35N — CID 155021843
(3E)-4,5,5,7,7,8-hexamethyl-N-propan-2-ylnona-1,3-dien-2-amine (PubChem CID 155021843) has the molecular formula C18H35N and a molecular weight of 265.48 g/mol. Its IUPAC name is (3E)-4,5,5,7,7,8-hexamethyl-N-propan-2-ylnona-1,3-dien-2-amine.
| Compound Name | (3E)-4,5,5,7,7,8-hexamethyl-N-propan-2-ylnona-1,3-dien-2-amine |
|---|---|
| PubChem CID | 155021843 |
| Molecular Formula | C18H35N |
| Molecular Weight | 265.48 g/mol |
| Exact Mass | 265.28 |
| IUPAC Name | (3E)-4,5,5,7,7,8-hexamethyl-N-propan-2-ylnona-1,3-dien-2-amine |
| SMILES | C=C(/C=C(\C)C(C)(C)CC(C)(C)C(C)C)NC(C)C |
| InChI | InChI=1S/C18H35N/c1-13(2)17(7,8)12-18(9,10)15(5)11-16(6)19-14(3)4/h11,13-14,19H,6,12H2,1-5,7-10H3/b15-11+ |
| InChIKey | FHEQRROIZFLGEL-RVDMUPIBSA-N |
| XLogP | 5.54 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.48 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|