C11H23N2P — CID 155021868
(2Z)-4-N-phosphanyl-1-N,2-di(propan-2-yl)penta-2,4-diene-1,4-diamine (PubChem CID 155021868) has the molecular formula C11H23N2P and a molecular weight of 214.29 g/mol. Its IUPAC name is (2Z)-4-N-phosphanyl-1-N,2-di(propan-2-yl)penta-2,4-diene-1,4-diamine.
| Compound Name | (2Z)-4-N-phosphanyl-1-N,2-di(propan-2-yl)penta-2,4-diene-1,4-diamine |
|---|---|
| PubChem CID | 155021868 |
| Molecular Formula | C11H23N2P |
| Molecular Weight | 214.29 g/mol |
| Exact Mass | 214.16 |
| IUPAC Name | (2Z)-4-N-phosphanyl-1-N,2-di(propan-2-yl)penta-2,4-diene-1,4-diamine |
| SMILES | C=C(/C=C(\CNC(C)C)C(C)C)NP |
| InChI | InChI=1S/C11H23N2P/c1-8(2)11(6-10(5)13-14)7-12-9(3)4/h6,8-9,12-13H,5,7,14H2,1-4H3/b11-6+ |
| InChIKey | GDEOKQDIUASFAS-IZZDOVSWSA-N |
| XLogP | 2.46 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.29 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|