About 3-(3'-methoxyspiro[adamantane-2,4'-dioxetane]-3'-yl)-5-[(3R)-3-methylpentyl]phenol
3-(3'-methoxyspiro[adamantane-2,4'-dioxetane]-3'-yl)-5-[(3R)-3-methylpentyl]phenol (PubChem CID 155021870) has the molecular formula C24H34O4
and a molecular weight of 386.53 g/mol. Its IUPAC name is 3-(3'-methoxyspiro[adamantane-2,4'-dioxetane]-3'-yl)-5-[(3R)-3-methylpentyl]phenol.
Molecular Properties
| Compound Name | 3-(3'-methoxyspiro[adamantane-2,4'-dioxetane]-3'-yl)-5-[(3R)-3-methylpentyl]phenol |
| PubChem CID | 155021870 |
| Molecular Formula | C24H34O4 |
| Molecular Weight | 386.53 g/mol |
| Exact Mass | 386.25 |
| IUPAC Name | 3-(3'-methoxyspiro[adamantane-2,4'-dioxetane]-3'-yl)-5-[(3R)-3-methylpentyl]phenol |
| SMILES | CC[C@@H](C)CCc1cc(O)cc(C2(OC)OOC23C2CC4CC(C2)CC3C4)c1 |
| InChI | InChI=1S/C24H34O4/c1-4-15(2)5-6-16-8-21(14-22(25)13-16)24(26-3)23(27-28-24)19-9-17-7-18(11-19)12-20(23)10-17/h8,13-15,17-20,25H,4-7,9-12H2,1-3H3/t15-,17?,18?,19?,20?,23?,24?/m1/s1 |
| InChIKey | HFYDVSVXGAIYLH-SDOICNHSSA-N |
| XLogP | 5.33 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 386.53 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 3-(3'-methoxyspiro[adamantane-2,4'-dioxetane]-3'-yl)-5-[(3R)-3-methylpentyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3'-methoxyspiro[adamantane-2,4'-dioxetane]-3'-yl)-5-[(3R)-3-methylpentyl]phenol?
The IUPAC name of 3-(3'-methoxyspiro[adamantane-2,4'-dioxetane]-3'-yl)-5-[(3R)-3-methylpentyl]phenol (CID 155021870) is 3-(3'-methoxyspiro[adamantane-2,4'-dioxetane]-3'-yl)-5-[(3R)-3-methylpentyl]phenol.
What is the SMILES notation for 3-(3'-methoxyspiro[adamantane-2,4'-dioxetane]-3'-yl)-5-[(3R)-3-methylpentyl]phenol?
The canonical SMILES for 3-(3'-methoxyspiro[adamantane-2,4'-dioxetane]-3'-yl)-5-[(3R)-3-methylpentyl]phenol is CC[C@@H](C)CCc1cc(O)cc(C2(OC)OOC23C2CC4CC(C2)CC3C4)c1.
What is the InChIKey of 3-(3'-methoxyspiro[adamantane-2,4'-dioxetane]-3'-yl)-5-[(3R)-3-methylpentyl]phenol?
The InChIKey is HFYDVSVXGAIYLH-SDOICNHSSA-N. The full InChI is InChI=1S/C24H34O4/c1-4-15(2)5-6-16-8-21(14-22(25)13-16)24(26-3)23(27-28-24)19-9-17-7-18(11-19)12-20(23)10-17/h8,13-15,17-20,25H,4-7,9-12H2,1-3H3/t15-,17?,18?,19?,20?,23?,24?/m1/s1.
What are the key properties of 3-(3'-methoxyspiro[adamantane-2,4'-dioxetane]-3'-yl)-5-[(3R)-3-methylpentyl]phenol?
3-(3'-methoxyspiro[adamantane-2,4'-dioxetane]-3'-yl)-5-[(3R)-3-methylpentyl]phenol has a molecular weight of 386.53 g/mol, XLogP of 5.33, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3'-methoxyspiro[adamantane-2,4'-dioxetane]-3'-yl)-5-[(3R)-3-methylpentyl]phenol is sourced from PubChem (CID 155021870), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).