About 3-[(1-oxo-2H-1,3-thiazol-3-yl)sulfonyl]-2H-1,3-thiazole 1-oxide
3-[(1-oxo-2H-1,3-thiazol-3-yl)sulfonyl]-2H-1,3-thiazole 1-oxide (PubChem CID 155021993) has the molecular formula C6H8N2O4S3
and a molecular weight of 268.34 g/mol. Its IUPAC name is 3-[(1-oxo-2H-1,3-thiazol-3-yl)sulfonyl]-2H-1,3-thiazole 1-oxide.
Molecular Properties
| Compound Name | 3-[(1-oxo-2H-1,3-thiazol-3-yl)sulfonyl]-2H-1,3-thiazole 1-oxide |
| PubChem CID | 155021993 |
| Molecular Formula | C6H8N2O4S3 |
| Molecular Weight | 268.34 g/mol |
| Exact Mass | 267.96 |
| IUPAC Name | 3-[(1-oxo-2H-1,3-thiazol-3-yl)sulfonyl]-2H-1,3-thiazole 1-oxide |
| SMILES | O=S1C=CN(S(=O)(=O)N2C=CS(=O)C2)C1 |
| InChI | InChI=1S/C6H8N2O4S3/c9-13-3-1-7(5-13)15(11,12)8-2-4-14(10)6-8/h1-4H,5-6H2 |
| InChIKey | FJEGZDCFHMAWLE-UHFFFAOYSA-N |
| XLogP | -0.78 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.34 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[(1-oxo-2H-1,3-thiazol-3-yl)sulfonyl]-2H-1,3-thiazole 1-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(1-oxo-2H-1,3-thiazol-3-yl)sulfonyl]-2H-1,3-thiazole 1-oxide?
The IUPAC name of 3-[(1-oxo-2H-1,3-thiazol-3-yl)sulfonyl]-2H-1,3-thiazole 1-oxide (CID 155021993) is 3-[(1-oxo-2H-1,3-thiazol-3-yl)sulfonyl]-2H-1,3-thiazole 1-oxide.
What is the SMILES notation for 3-[(1-oxo-2H-1,3-thiazol-3-yl)sulfonyl]-2H-1,3-thiazole 1-oxide?
The canonical SMILES for 3-[(1-oxo-2H-1,3-thiazol-3-yl)sulfonyl]-2H-1,3-thiazole 1-oxide is O=S1C=CN(S(=O)(=O)N2C=CS(=O)C2)C1.
What is the InChIKey of 3-[(1-oxo-2H-1,3-thiazol-3-yl)sulfonyl]-2H-1,3-thiazole 1-oxide?
The InChIKey is FJEGZDCFHMAWLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2O4S3/c9-13-3-1-7(5-13)15(11,12)8-2-4-14(10)6-8/h1-4H,5-6H2.
What are the key properties of 3-[(1-oxo-2H-1,3-thiazol-3-yl)sulfonyl]-2H-1,3-thiazole 1-oxide?
3-[(1-oxo-2H-1,3-thiazol-3-yl)sulfonyl]-2H-1,3-thiazole 1-oxide has a molecular weight of 268.34 g/mol, XLogP of -0.78, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(1-oxo-2H-1,3-thiazol-3-yl)sulfonyl]-2H-1,3-thiazole 1-oxide is sourced from PubChem (CID 155021993), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).