C11H3F6I3O4 — CID 155022327
2,3,5-triiodo-6-[3,3,3-trifluoro-2-(trifluoromethyl)propanoyl]oxybenzoic acid (PubChem CID 155022327) has the molecular formula C11H3F6I3O4 and a molecular weight of 693.84 g/mol. Its IUPAC name is 2,3,5-triiodo-6-[3,3,3-trifluoro-2-(trifluoromethyl)propanoyl]oxybenzoic acid.
| Compound Name | 2,3,5-triiodo-6-[3,3,3-trifluoro-2-(trifluoromethyl)propanoyl]oxybenzoic acid |
|---|---|
| PubChem CID | 155022327 |
| Molecular Formula | C11H3F6I3O4 |
| Molecular Weight | 693.84 g/mol |
| Exact Mass | 693.71 |
| IUPAC Name | 2,3,5-triiodo-6-[3,3,3-trifluoro-2-(trifluoromethyl)propanoyl]oxybenzoic acid |
| SMILES | O=C(O)c1c(I)c(I)cc(I)c1OC(=O)C(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C11H3F6I3O4/c12-10(13,14)7(11(15,16)17)9(23)24-6-3(19)1-2(18)5(20)4(6)8(21)22/h1,7H,(H,21,22) |
| InChIKey | DEHSMHSCCOVDAE-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.84 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|