C16H10F2N2O3 — CID 155023000
1,3-bis(4-fluorophenyl)-1,3-diazinane-2,4,6-trione (PubChem CID 155023000) has the molecular formula C16H10F2N2O3 and a molecular weight of 316.26 g/mol. Its IUPAC name is 1,3-bis(4-fluorophenyl)-1,3-diazinane-2,4,6-trione.
| Compound Name | 1,3-bis(4-fluorophenyl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 155023000 |
| Molecular Formula | C16H10F2N2O3 |
| Molecular Weight | 316.26 g/mol |
| Exact Mass | 316.07 |
| IUPAC Name | 1,3-bis(4-fluorophenyl)-1,3-diazinane-2,4,6-trione |
| SMILES | O=C1CC(=O)N(c2ccc(F)cc2)C(=O)N1c1ccc(F)cc1 |
| InChI | InChI=1S/C16H10F2N2O3/c17-10-1-5-12(6-2-10)19-14(21)9-15(22)20(16(19)23)13-7-3-11(18)4-8-13/h1-8H,9H2 |
| InChIKey | PEBQVIFUUMNSJO-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.26 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|