C14H19N — CID 155023347
(4R,12R)-4,8,12-trimethyl-2-azatricyclo[7.3.0.03,7]dodeca-1,3(7),8-triene (PubChem CID 155023347) has the molecular formula C14H19N and a molecular weight of 201.31 g/mol. Its IUPAC name is (4R,12R)-4,8,12-trimethyl-2-azatricyclo[7.3.0.03,7]dodeca-1,3(7),8-triene.
| Compound Name | (4R,12R)-4,8,12-trimethyl-2-azatricyclo[7.3.0.03,7]dodeca-1,3(7),8-triene |
|---|---|
| PubChem CID | 155023347 |
| Molecular Formula | C14H19N |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.15 |
| IUPAC Name | (4R,12R)-4,8,12-trimethyl-2-azatricyclo[7.3.0.03,7]dodeca-1,3(7),8-triene |
| SMILES | Cc1c2c(nc3c1CC[C@H]3C)[C@H](C)CC2 |
| InChI | InChI=1S/C14H19N/c1-8-4-6-11-10(3)12-7-5-9(2)14(12)15-13(8)11/h8-9H,4-7H2,1-3H3/t8-,9-/m1/s1 |
| InChIKey | JZGUAYDSDJTXRF-RKDXNWHRSA-N |
| XLogP | 3.49 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |