About N-[2-(3,7-dimethyloctylsulfanyl)ethyl]-N-propylpropan-1-amine
N-[2-(3,7-dimethyloctylsulfanyl)ethyl]-N-propylpropan-1-amine (PubChem CID 155023428) has the molecular formula C18H39NS
and a molecular weight of 301.58 g/mol. Its IUPAC name is N-[2-(3,7-dimethyloctylsulfanyl)ethyl]-N-propylpropan-1-amine.
Molecular Properties
| Compound Name | N-[2-(3,7-dimethyloctylsulfanyl)ethyl]-N-propylpropan-1-amine |
| PubChem CID | 155023428 |
| Molecular Formula | C18H39NS |
| Molecular Weight | 301.58 g/mol |
| Exact Mass | 301.28 |
| IUPAC Name | N-[2-(3,7-dimethyloctylsulfanyl)ethyl]-N-propylpropan-1-amine |
| SMILES | CCCN(CCC)CCSCCC(C)CCCC(C)C |
| InChI | InChI=1S/C18H39NS/c1-6-12-19(13-7-2)14-16-20-15-11-18(5)10-8-9-17(3)4/h17-18H,6-16H2,1-5H3 |
| InChIKey | AORXTWWTRYJPPP-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 301.58 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[2-(3,7-dimethyloctylsulfanyl)ethyl]-N-propylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(3,7-dimethyloctylsulfanyl)ethyl]-N-propylpropan-1-amine?
The IUPAC name of N-[2-(3,7-dimethyloctylsulfanyl)ethyl]-N-propylpropan-1-amine (CID 155023428) is N-[2-(3,7-dimethyloctylsulfanyl)ethyl]-N-propylpropan-1-amine.
What is the SMILES notation for N-[2-(3,7-dimethyloctylsulfanyl)ethyl]-N-propylpropan-1-amine?
The canonical SMILES for N-[2-(3,7-dimethyloctylsulfanyl)ethyl]-N-propylpropan-1-amine is CCCN(CCC)CCSCCC(C)CCCC(C)C.
What is the InChIKey of N-[2-(3,7-dimethyloctylsulfanyl)ethyl]-N-propylpropan-1-amine?
The InChIKey is AORXTWWTRYJPPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H39NS/c1-6-12-19(13-7-2)14-16-20-15-11-18(5)10-8-9-17(3)4/h17-18H,6-16H2,1-5H3.
What are the key properties of N-[2-(3,7-dimethyloctylsulfanyl)ethyl]-N-propylpropan-1-amine?
N-[2-(3,7-dimethyloctylsulfanyl)ethyl]-N-propylpropan-1-amine has a molecular weight of 301.58 g/mol, XLogP of 5.69, 14 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(3,7-dimethyloctylsulfanyl)ethyl]-N-propylpropan-1-amine is sourced from PubChem (CID 155023428), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).