About 1-methylpiperidin-4-one;trifluoromethanesulfonic acid
1-methylpiperidin-4-one;trifluoromethanesulfonic acid (PubChem CID 155024108) has the molecular formula C7H12F3NO4S
and a molecular weight of 263.24 g/mol. Its IUPAC name is 1-methylpiperidin-4-one;trifluoromethanesulfonic acid.
Molecular Properties
| Compound Name | 1-methylpiperidin-4-one;trifluoromethanesulfonic acid |
| PubChem CID | 155024108 |
| Molecular Formula | C7H12F3NO4S |
| Molecular Weight | 263.24 g/mol |
| Exact Mass | 263.04 |
| IUPAC Name | 1-methylpiperidin-4-one;trifluoromethanesulfonic acid |
| SMILES | CN1CCC(=O)CC1.O=S(=O)(O)C(F)(F)F |
| InChI | InChI=1S/C6H11NO.CHF3O3S/c1-7-4-2-6(8)3-5-7;2-1(3,4)8(5,6)7/h2-5H2,1H3;(H,5,6,7) |
| InChIKey | QZBZDJXWUZYBTK-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.24 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze 1-methylpiperidin-4-one;trifluoromethanesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methylpiperidin-4-one;trifluoromethanesulfonic acid?
The IUPAC name of 1-methylpiperidin-4-one;trifluoromethanesulfonic acid (CID 155024108) is 1-methylpiperidin-4-one;trifluoromethanesulfonic acid.
What is the SMILES notation for 1-methylpiperidin-4-one;trifluoromethanesulfonic acid?
The canonical SMILES for 1-methylpiperidin-4-one;trifluoromethanesulfonic acid is CN1CCC(=O)CC1.O=S(=O)(O)C(F)(F)F.
What is the InChIKey of 1-methylpiperidin-4-one;trifluoromethanesulfonic acid?
The InChIKey is QZBZDJXWUZYBTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NO.CHF3O3S/c1-7-4-2-6(8)3-5-7;2-1(3,4)8(5,6)7/h2-5H2,1H3;(H,5,6,7).
What are the key properties of 1-methylpiperidin-4-one;trifluoromethanesulfonic acid?
1-methylpiperidin-4-one;trifluoromethanesulfonic acid has a molecular weight of 263.24 g/mol, XLogP of 0.68, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methylpiperidin-4-one;trifluoromethanesulfonic acid is sourced from PubChem (CID 155024108), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).