About methanesulfonic acid;1-methylpiperidin-4-one
methanesulfonic acid;1-methylpiperidin-4-one (PubChem CID 155024121) has the molecular formula C7H15NO4S
and a molecular weight of 209.27 g/mol. Its IUPAC name is methanesulfonic acid;1-methylpiperidin-4-one.
Molecular Properties
| Compound Name | methanesulfonic acid;1-methylpiperidin-4-one |
| PubChem CID | 155024121 |
| Molecular Formula | C7H15NO4S |
| Molecular Weight | 209.27 g/mol |
| Exact Mass | 209.07 |
| IUPAC Name | methanesulfonic acid;1-methylpiperidin-4-one |
| SMILES | CN1CCC(=O)CC1.CS(=O)(=O)O |
| InChI | InChI=1S/C6H11NO.CH4O3S/c1-7-4-2-6(8)3-5-7;1-5(2,3)4/h2-5H2,1H3;1H3,(H,2,3,4) |
| InChIKey | QNZCAFVAQWWQGB-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.27 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze methanesulfonic acid;1-methylpiperidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanesulfonic acid;1-methylpiperidin-4-one?
The IUPAC name of methanesulfonic acid;1-methylpiperidin-4-one (CID 155024121) is methanesulfonic acid;1-methylpiperidin-4-one.
What is the SMILES notation for methanesulfonic acid;1-methylpiperidin-4-one?
The canonical SMILES for methanesulfonic acid;1-methylpiperidin-4-one is CN1CCC(=O)CC1.CS(=O)(=O)O.
What is the InChIKey of methanesulfonic acid;1-methylpiperidin-4-one?
The InChIKey is QNZCAFVAQWWQGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NO.CH4O3S/c1-7-4-2-6(8)3-5-7;1-5(2,3)4/h2-5H2,1H3;1H3,(H,2,3,4).
What are the key properties of methanesulfonic acid;1-methylpiperidin-4-one?
methanesulfonic acid;1-methylpiperidin-4-one has a molecular weight of 209.27 g/mol, XLogP of -0.21, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methanesulfonic acid;1-methylpiperidin-4-one is sourced from PubChem (CID 155024121), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).