C18H25ClF3N3O4 — CID 155024291
2-chloro-N,N-dimethyl-6-(3-piperidin-4-ylpropoxy)pyridine-3-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 155024291) has the molecular formula C18H25ClF3N3O4 and a molecular weight of 439.86 g/mol. Its IUPAC name is 2-chloro-N,N-dimethyl-6-(3-piperidin-4-ylpropoxy)pyridine-3-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | 2-chloro-N,N-dimethyl-6-(3-piperidin-4-ylpropoxy)pyridine-3-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155024291 |
| Molecular Formula | C18H25ClF3N3O4 |
| Molecular Weight | 439.86 g/mol |
| Exact Mass | 439.15 |
| IUPAC Name | 2-chloro-N,N-dimethyl-6-(3-piperidin-4-ylpropoxy)pyridine-3-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | CN(C)C(=O)c1ccc(OCCCC2CCNCC2)nc1Cl.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C16H24ClN3O2.C2HF3O2/c1-20(2)16(21)13-5-6-14(19-15(13)17)22-11-3-4-12-7-9-18-10-8-12;3-2(4,5)1(6)7/h5-6,12,18H,3-4,7-11H2,1-2H3;(H,6,7) |
| InChIKey | FYMCJSJHQDNILY-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 91.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.86 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|