C11H12F3N3O3 — CID 155024372
1-methyl-4-[1-methyl-5-(trifluoromethyl)pyrazol-4-yl]-2-oxopyrrolidine-3-carboxylic acid (PubChem CID 155024372) has the molecular formula C11H12F3N3O3 and a molecular weight of 291.23 g/mol. Its IUPAC name is 1-methyl-4-[1-methyl-5-(trifluoromethyl)pyrazol-4-yl]-2-oxopyrrolidine-3-carboxylic acid.
| Compound Name | 1-methyl-4-[1-methyl-5-(trifluoromethyl)pyrazol-4-yl]-2-oxopyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 155024372 |
| Molecular Formula | C11H12F3N3O3 |
| Molecular Weight | 291.23 g/mol |
| Exact Mass | 291.08 |
| IUPAC Name | 1-methyl-4-[1-methyl-5-(trifluoromethyl)pyrazol-4-yl]-2-oxopyrrolidine-3-carboxylic acid |
| SMILES | CN1CC(c2cnn(C)c2C(F)(F)F)C(C(=O)O)C1=O |
| InChI | InChI=1S/C11H12F3N3O3/c1-16-4-6(7(9(16)18)10(19)20)5-3-15-17(2)8(5)11(12,13)14/h3,6-7H,4H2,1-2H3,(H,19,20) |
| InChIKey | JFONVTJZTOGUMF-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.23 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|