C38H50FN7O4 — CID 155024675
N-[2-[4-[4-(4-benzylpiperazin-1-yl)-4-oxo-3-(propanoylamino)butan-2-yl]-2-fluoroanilino]-1-cyclohexyl-2-oxoethyl]-2-ethylpyrazole-3-carboxamide (PubChem CID 155024675) has the molecular formula C38H50FN7O4 and a molecular weight of 687.86 g/mol. Its IUPAC name is N-[2-[4-[4-(4-benzylpiperazin-1-yl)-4-oxo-3-(propanoylamino)butan-2-yl]-2-fluoroanilino]-1-cyclohexyl-2-oxoethyl]-2-ethylpyrazole-3-carboxamide.
| Compound Name | N-[2-[4-[4-(4-benzylpiperazin-1-yl)-4-oxo-3-(propanoylamino)butan-2-yl]-2-fluoroanilino]-1-cyclohexyl-2-oxoethyl]-2-ethylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 155024675 |
| Molecular Formula | C38H50FN7O4 |
| Molecular Weight | 687.86 g/mol |
| Exact Mass | 687.39 |
| IUPAC Name | N-[2-[4-[4-(4-benzylpiperazin-1-yl)-4-oxo-3-(propanoylamino)butan-2-yl]-2-fluoroanilino]-1-cyclohexyl-2-oxoethyl]-2-ethylpyrazole-3-carboxamide |
| SMILES | CCC(=O)NC(C(=O)N1CCN(Cc2ccccc2)CC1)C(C)c1ccc(NC(=O)C(NC(=O)c2ccnn2CC)C2CCCCC2)c(F)c1 |
| InChI | InChI=1S/C38H50FN7O4/c1-4-33(47)42-34(38(50)45-22-20-44(21-23-45)25-27-12-8-6-9-13-27)26(3)29-16-17-31(30(39)24-29)41-37(49)35(28-14-10-7-11-15-28)43-36(48)32-18-19-40-46(32)5-2/h6,8-9,12-13,16-19,24,26,28,34-35H,4-5,7,10-11,14-15,20-23,25H2,1-3H3,(H,41,49)(H,42,47)(H,43,48) |
| InChIKey | BTKOQNCORBXUNI-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 128.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.86 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |