About 2-(2-methyl-1,3-thiazol-5-yl)-N-[5-[3-(oxan-2-yl)cyclopentyl]-1H-pyrazol-3-yl]acetamide
2-(2-methyl-1,3-thiazol-5-yl)-N-[5-[3-(oxan-2-yl)cyclopentyl]-1H-pyrazol-3-yl]acetamide (PubChem CID 155025561) has the molecular formula C19H26N4O2S
and a molecular weight of 374.51 g/mol. Its IUPAC name is 2-(2-methyl-1,3-thiazol-5-yl)-N-[5-[3-(oxan-2-yl)cyclopentyl]-1H-pyrazol-3-yl]acetamide.
Molecular Properties
| Compound Name | 2-(2-methyl-1,3-thiazol-5-yl)-N-[5-[3-(oxan-2-yl)cyclopentyl]-1H-pyrazol-3-yl]acetamide |
| PubChem CID | 155025561 |
| Molecular Formula | C19H26N4O2S |
| Molecular Weight | 374.51 g/mol |
| Exact Mass | 374.18 |
| IUPAC Name | 2-(2-methyl-1,3-thiazol-5-yl)-N-[5-[3-(oxan-2-yl)cyclopentyl]-1H-pyrazol-3-yl]acetamide |
| SMILES | Cc1ncc(CC(=O)Nc2cc(C3CCC(C4CCCCO4)C3)[nH]n2)s1 |
| InChI | InChI=1S/C19H26N4O2S/c1-12-20-11-15(26-12)9-19(24)21-18-10-16(22-23-18)13-5-6-14(8-13)17-4-2-3-7-25-17/h10-11,13-14,17H,2-9H2,1H3,(H2,21,22,23,24) |
| InChIKey | DLJYDPNCQOMADQ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.51 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(2-methyl-1,3-thiazol-5-yl)-N-[5-[3-(oxan-2-yl)cyclopentyl]-1H-pyrazol-3-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-methyl-1,3-thiazol-5-yl)-N-[5-[3-(oxan-2-yl)cyclopentyl]-1H-pyrazol-3-yl]acetamide?
The IUPAC name of 2-(2-methyl-1,3-thiazol-5-yl)-N-[5-[3-(oxan-2-yl)cyclopentyl]-1H-pyrazol-3-yl]acetamide (CID 155025561) is 2-(2-methyl-1,3-thiazol-5-yl)-N-[5-[3-(oxan-2-yl)cyclopentyl]-1H-pyrazol-3-yl]acetamide.
What is the SMILES notation for 2-(2-methyl-1,3-thiazol-5-yl)-N-[5-[3-(oxan-2-yl)cyclopentyl]-1H-pyrazol-3-yl]acetamide?
The canonical SMILES for 2-(2-methyl-1,3-thiazol-5-yl)-N-[5-[3-(oxan-2-yl)cyclopentyl]-1H-pyrazol-3-yl]acetamide is Cc1ncc(CC(=O)Nc2cc(C3CCC(C4CCCCO4)C3)[nH]n2)s1.
What is the InChIKey of 2-(2-methyl-1,3-thiazol-5-yl)-N-[5-[3-(oxan-2-yl)cyclopentyl]-1H-pyrazol-3-yl]acetamide?
The InChIKey is DLJYDPNCQOMADQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H26N4O2S/c1-12-20-11-15(26-12)9-19(24)21-18-10-16(22-23-18)13-5-6-14(8-13)17-4-2-3-7-25-17/h10-11,13-14,17H,2-9H2,1H3,(H2,21,22,23,24).
What are the key properties of 2-(2-methyl-1,3-thiazol-5-yl)-N-[5-[3-(oxan-2-yl)cyclopentyl]-1H-pyrazol-3-yl]acetamide?
2-(2-methyl-1,3-thiazol-5-yl)-N-[5-[3-(oxan-2-yl)cyclopentyl]-1H-pyrazol-3-yl]acetamide has a molecular weight of 374.51 g/mol, XLogP of 3.81, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-methyl-1,3-thiazol-5-yl)-N-[5-[3-(oxan-2-yl)cyclopentyl]-1H-pyrazol-3-yl]acetamide is sourced from PubChem (CID 155025561), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).