About 4-(3,3-difluoropyrrolidin-1-yl)-N-fluoroaniline
4-(3,3-difluoropyrrolidin-1-yl)-N-fluoroaniline (PubChem CID 155026115) has the molecular formula C10H11F3N2
and a molecular weight of 216.21 g/mol. Its IUPAC name is 4-(3,3-difluoropyrrolidin-1-yl)-N-fluoroaniline.
Molecular Properties
| Compound Name | 4-(3,3-difluoropyrrolidin-1-yl)-N-fluoroaniline |
| PubChem CID | 155026115 |
| Molecular Formula | C10H11F3N2 |
| Molecular Weight | 216.21 g/mol |
| Exact Mass | 216.09 |
| IUPAC Name | 4-(3,3-difluoropyrrolidin-1-yl)-N-fluoroaniline |
| SMILES | FNc1ccc(N2CCC(F)(F)C2)cc1 |
| InChI | InChI=1S/C10H11F3N2/c11-10(12)5-6-15(7-10)9-3-1-8(14-13)2-4-9/h1-4,14H,5-7H2 |
| InChIKey | AXIWFHPSEXILGA-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.21 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze 4-(3,3-difluoropyrrolidin-1-yl)-N-fluoroaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3,3-difluoropyrrolidin-1-yl)-N-fluoroaniline?
The IUPAC name of 4-(3,3-difluoropyrrolidin-1-yl)-N-fluoroaniline (CID 155026115) is 4-(3,3-difluoropyrrolidin-1-yl)-N-fluoroaniline.
What is the SMILES notation for 4-(3,3-difluoropyrrolidin-1-yl)-N-fluoroaniline?
The canonical SMILES for 4-(3,3-difluoropyrrolidin-1-yl)-N-fluoroaniline is FNc1ccc(N2CCC(F)(F)C2)cc1.
What is the InChIKey of 4-(3,3-difluoropyrrolidin-1-yl)-N-fluoroaniline?
The InChIKey is AXIWFHPSEXILGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11F3N2/c11-10(12)5-6-15(7-10)9-3-1-8(14-13)2-4-9/h1-4,14H,5-7H2.
What are the key properties of 4-(3,3-difluoropyrrolidin-1-yl)-N-fluoroaniline?
4-(3,3-difluoropyrrolidin-1-yl)-N-fluoroaniline has a molecular weight of 216.21 g/mol, XLogP of 2.83, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3,3-difluoropyrrolidin-1-yl)-N-fluoroaniline is sourced from PubChem (CID 155026115), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).