C18H24N2O — CID 155027116
4-amino-2-[(1R,2S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]-3H-isoindol-1-one (PubChem CID 155027116) has the molecular formula C18H24N2O and a molecular weight of 284.40 g/mol. Its IUPAC name is 4-amino-2-[(1R,2S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]-3H-isoindol-1-one.
| Compound Name | 4-amino-2-[(1R,2S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]-3H-isoindol-1-one |
|---|---|
| PubChem CID | 155027116 |
| Molecular Formula | C18H24N2O |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.19 |
| IUPAC Name | 4-amino-2-[(1R,2S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]-3H-isoindol-1-one |
| SMILES | CC1(C)[C@@H]2CC[C@@]1(C)[C@@H](N1Cc3c(N)cccc3C1=O)C2 |
| InChI | InChI=1S/C18H24N2O/c1-17(2)11-7-8-18(17,3)15(9-11)20-10-13-12(16(20)21)5-4-6-14(13)19/h4-6,11,15H,7-10,19H2,1-3H3/t11-,15+,18+/m1/s1 |
| InChIKey | PEILDIYCHBQERK-PSZVPEGOSA-N |
| XLogP | 3.44 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|