C21H19N3O2 — CID 155027257
methyl 4-[6-[(1Z,3E)-1-(methylideneamino)penta-1,3-dien-3-yl]imidazo[1,2-a]pyridin-3-yl]benzoate (PubChem CID 155027257) has the molecular formula C21H19N3O2 and a molecular weight of 345.40 g/mol. Its IUPAC name is methyl 4-[6-[(1Z,3E)-1-(methylideneamino)penta-1,3-dien-3-yl]imidazo[1,2-a]pyridin-3-yl]benzoate.
| Compound Name | methyl 4-[6-[(1Z,3E)-1-(methylideneamino)penta-1,3-dien-3-yl]imidazo[1,2-a]pyridin-3-yl]benzoate |
|---|---|
| PubChem CID | 155027257 |
| Molecular Formula | C21H19N3O2 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.15 |
| IUPAC Name | methyl 4-[6-[(1Z,3E)-1-(methylideneamino)penta-1,3-dien-3-yl]imidazo[1,2-a]pyridin-3-yl]benzoate |
| SMILES | C=N/C=C\C(=C/C)c1ccc2ncc(-c3ccc(C(=O)OC)cc3)n2c1 |
| InChI | InChI=1S/C21H19N3O2/c1-4-15(11-12-22-2)18-9-10-20-23-13-19(24(20)14-18)16-5-7-17(8-6-16)21(25)26-3/h4-14H,2H2,1,3H3/b12-11-,15-4+ |
| InChIKey | JGKUHPIBWALGTL-SIWLUJLRSA-N |
| XLogP | 4.41 |
| TPSA | 55.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|