C15H25NO2 — CID 155027493
(2E,7E,9E)-9-hydroxyimino-5,5,10,10-tetramethylundeca-2,7-dien-4-one (PubChem CID 155027493) has the molecular formula C15H25NO2 and a molecular weight of 251.37 g/mol. Its IUPAC name is (2E,7E,9E)-9-hydroxyimino-5,5,10,10-tetramethylundeca-2,7-dien-4-one.
| Compound Name | (2E,7E,9E)-9-hydroxyimino-5,5,10,10-tetramethylundeca-2,7-dien-4-one |
|---|---|
| PubChem CID | 155027493 |
| Molecular Formula | C15H25NO2 |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.19 |
| IUPAC Name | (2E,7E,9E)-9-hydroxyimino-5,5,10,10-tetramethylundeca-2,7-dien-4-one |
| SMILES | C/C=C/C(=O)C(C)(C)C/C=C/C(=N\O)C(C)(C)C |
| InChI | InChI=1S/C15H25NO2/c1-7-9-13(17)15(5,6)11-8-10-12(16-18)14(2,3)4/h7-10,18H,11H2,1-6H3/b9-7+,10-8+,16-12+ |
| InChIKey | HOFYWZPTJKBLGH-MKNRKCSJSA-N |
| XLogP | 3.98 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|