About N'-(4-ethyl-2-methylphenyl)-N,N'-dimethylmethanediamine
N'-(4-ethyl-2-methylphenyl)-N,N'-dimethylmethanediamine (PubChem CID 155027571) has the molecular formula C12H20N2
and a molecular weight of 192.31 g/mol. Its IUPAC name is N'-(4-ethyl-2-methylphenyl)-N,N'-dimethylmethanediamine.
Molecular Properties
| Compound Name | N'-(4-ethyl-2-methylphenyl)-N,N'-dimethylmethanediamine |
| PubChem CID | 155027571 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | N'-(4-ethyl-2-methylphenyl)-N,N'-dimethylmethanediamine |
| SMILES | CCc1ccc(N(C)CNC)c(C)c1 |
| InChI | InChI=1S/C12H20N2/c1-5-11-6-7-12(10(2)8-11)14(4)9-13-3/h6-8,13H,5,9H2,1-4H3 |
| InChIKey | KAHFMJIPTVXUFI-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze N'-(4-ethyl-2-methylphenyl)-N,N'-dimethylmethanediamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(4-ethyl-2-methylphenyl)-N,N'-dimethylmethanediamine?
The IUPAC name of N'-(4-ethyl-2-methylphenyl)-N,N'-dimethylmethanediamine (CID 155027571) is N'-(4-ethyl-2-methylphenyl)-N,N'-dimethylmethanediamine.
What is the SMILES notation for N'-(4-ethyl-2-methylphenyl)-N,N'-dimethylmethanediamine?
The canonical SMILES for N'-(4-ethyl-2-methylphenyl)-N,N'-dimethylmethanediamine is CCc1ccc(N(C)CNC)c(C)c1.
What is the InChIKey of N'-(4-ethyl-2-methylphenyl)-N,N'-dimethylmethanediamine?
The InChIKey is KAHFMJIPTVXUFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20N2/c1-5-11-6-7-12(10(2)8-11)14(4)9-13-3/h6-8,13H,5,9H2,1-4H3.
What are the key properties of N'-(4-ethyl-2-methylphenyl)-N,N'-dimethylmethanediamine?
N'-(4-ethyl-2-methylphenyl)-N,N'-dimethylmethanediamine has a molecular weight of 192.31 g/mol, XLogP of 2.17, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(4-ethyl-2-methylphenyl)-N,N'-dimethylmethanediamine is sourced from PubChem (CID 155027571), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).