C15H25N3 — CID 155027595
N'-[2-[[(3Z,5Z)-3-methylhepta-1,3,5-trien-2-yl]-prop-1-en-2-ylamino]ethyl]ethanimidamide (PubChem CID 155027595) has the molecular formula C15H25N3 and a molecular weight of 247.39 g/mol. Its IUPAC name is N'-[2-[[(3Z,5Z)-3-methylhepta-1,3,5-trien-2-yl]-prop-1-en-2-ylamino]ethyl]ethanimidamide.
| Compound Name | N'-[2-[[(3Z,5Z)-3-methylhepta-1,3,5-trien-2-yl]-prop-1-en-2-ylamino]ethyl]ethanimidamide |
|---|---|
| PubChem CID | 155027595 |
| Molecular Formula | C15H25N3 |
| Molecular Weight | 247.39 g/mol |
| Exact Mass | 247.20 |
| IUPAC Name | N'-[2-[[(3Z,5Z)-3-methylhepta-1,3,5-trien-2-yl]-prop-1-en-2-ylamino]ethyl]ethanimidamide |
| SMILES | C=C(C)N(CC/N=C(\C)N)C(=C)/C(C)=C\C=C/C |
| InChI | InChI=1S/C15H25N3/c1-7-8-9-13(4)14(5)18(12(2)3)11-10-17-15(6)16/h7-9H,2,5,10-11H2,1,3-4,6H3,(H2,16,17)/b8-7-,13-9- |
| InChIKey | NGFUVNABQMUJHE-VBKTUFRMSA-N |
| XLogP | 3.24 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.39 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|