C13H17NO — CID 155027621
2-methyl-3-[(3E,5Z)-octa-3,5,7-trien-4-yl]oxazine (PubChem CID 155027621) has the molecular formula C13H17NO and a molecular weight of 203.28 g/mol. Its IUPAC name is 2-methyl-3-[(3E,5Z)-octa-3,5,7-trien-4-yl]oxazine.
| Compound Name | 2-methyl-3-[(3E,5Z)-octa-3,5,7-trien-4-yl]oxazine |
|---|---|
| PubChem CID | 155027621 |
| Molecular Formula | C13H17NO |
| Molecular Weight | 203.28 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | 2-methyl-3-[(3E,5Z)-octa-3,5,7-trien-4-yl]oxazine |
| SMILES | C=C/C=C\C(=C/CC)C1=CC=CON1C |
| InChI | InChI=1S/C13H17NO/c1-4-6-9-12(8-5-2)13-10-7-11-15-14(13)3/h4,6-11H,1,5H2,2-3H3/b9-6-,12-8+ |
| InChIKey | ODIAKRYBZXINEX-QYPWSSHISA-N |
| XLogP | 3.34 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.28 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|