About 4-[(4,5-dimethyl-1,3-thiazol-2-yl)-[2-(2-oxopyrrolidin-1-yl)ethyl]amino]benzonitrile
4-[(4,5-dimethyl-1,3-thiazol-2-yl)-[2-(2-oxopyrrolidin-1-yl)ethyl]amino]benzonitrile (PubChem CID 155027734) has the molecular formula C18H20N4OS
and a molecular weight of 340.45 g/mol. Its IUPAC name is 4-[(4,5-dimethyl-1,3-thiazol-2-yl)-[2-(2-oxopyrrolidin-1-yl)ethyl]amino]benzonitrile.
Molecular Properties
| Compound Name | 4-[(4,5-dimethyl-1,3-thiazol-2-yl)-[2-(2-oxopyrrolidin-1-yl)ethyl]amino]benzonitrile |
| PubChem CID | 155027734 |
| Molecular Formula | C18H20N4OS |
| Molecular Weight | 340.45 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | 4-[(4,5-dimethyl-1,3-thiazol-2-yl)-[2-(2-oxopyrrolidin-1-yl)ethyl]amino]benzonitrile |
| SMILES | Cc1nc(N(CCN2CCCC2=O)c2ccc(C#N)cc2)sc1C |
| InChI | InChI=1S/C18H20N4OS/c1-13-14(2)24-18(20-13)22(11-10-21-9-3-4-17(21)23)16-7-5-15(12-19)6-8-16/h5-8H,3-4,9-11H2,1-2H3 |
| InChIKey | AEWAMPMINDWHAV-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 60.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.45 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[(4,5-dimethyl-1,3-thiazol-2-yl)-[2-(2-oxopyrrolidin-1-yl)ethyl]amino]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(4,5-dimethyl-1,3-thiazol-2-yl)-[2-(2-oxopyrrolidin-1-yl)ethyl]amino]benzonitrile?
The IUPAC name of 4-[(4,5-dimethyl-1,3-thiazol-2-yl)-[2-(2-oxopyrrolidin-1-yl)ethyl]amino]benzonitrile (CID 155027734) is 4-[(4,5-dimethyl-1,3-thiazol-2-yl)-[2-(2-oxopyrrolidin-1-yl)ethyl]amino]benzonitrile.
What is the SMILES notation for 4-[(4,5-dimethyl-1,3-thiazol-2-yl)-[2-(2-oxopyrrolidin-1-yl)ethyl]amino]benzonitrile?
The canonical SMILES for 4-[(4,5-dimethyl-1,3-thiazol-2-yl)-[2-(2-oxopyrrolidin-1-yl)ethyl]amino]benzonitrile is Cc1nc(N(CCN2CCCC2=O)c2ccc(C#N)cc2)sc1C.
What is the InChIKey of 4-[(4,5-dimethyl-1,3-thiazol-2-yl)-[2-(2-oxopyrrolidin-1-yl)ethyl]amino]benzonitrile?
The InChIKey is AEWAMPMINDWHAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20N4OS/c1-13-14(2)24-18(20-13)22(11-10-21-9-3-4-17(21)23)16-7-5-15(12-19)6-8-16/h5-8H,3-4,9-11H2,1-2H3.
What are the key properties of 4-[(4,5-dimethyl-1,3-thiazol-2-yl)-[2-(2-oxopyrrolidin-1-yl)ethyl]amino]benzonitrile?
4-[(4,5-dimethyl-1,3-thiazol-2-yl)-[2-(2-oxopyrrolidin-1-yl)ethyl]amino]benzonitrile has a molecular weight of 340.45 g/mol, XLogP of 3.39, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(4,5-dimethyl-1,3-thiazol-2-yl)-[2-(2-oxopyrrolidin-1-yl)ethyl]amino]benzonitrile is sourced from PubChem (CID 155027734), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).