C9H15NS — CID 155028433
2,5-dimethyl-2,3,3a,4,5,7a-hexahydro-1,3-benzothiazole (PubChem CID 155028433) has the molecular formula C9H15NS and a molecular weight of 169.29 g/mol. Its IUPAC name is 2,5-dimethyl-2,3,3a,4,5,7a-hexahydro-1,3-benzothiazole.
| Compound Name | 2,5-dimethyl-2,3,3a,4,5,7a-hexahydro-1,3-benzothiazole |
|---|---|
| PubChem CID | 155028433 |
| Molecular Formula | C9H15NS |
| Molecular Weight | 169.29 g/mol |
| Exact Mass | 169.09 |
| IUPAC Name | 2,5-dimethyl-2,3,3a,4,5,7a-hexahydro-1,3-benzothiazole |
| SMILES | CC1C=CC2SC(C)NC2C1 |
| InChI | InChI=1S/C9H15NS/c1-6-3-4-9-8(5-6)10-7(2)11-9/h3-4,6-10H,5H2,1-2H3 |
| InChIKey | KDYRRJSHDFVQND-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.29 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|