C21H27NO — CID 155028467
2-[(2R,4R,11R)-1,11-dimethyl-18-azapentacyclo[9.6.1.02,4.05,10.012,17]octadeca-5,7,9,13-tetraen-4-yl]ethanol (PubChem CID 155028467) has the molecular formula C21H27NO and a molecular weight of 309.45 g/mol. Its IUPAC name is 2-[(2R,4R,11R)-1,11-dimethyl-18-azapentacyclo[9.6.1.02,4.05,10.012,17]octadeca-5,7,9,13-tetraen-4-yl]ethanol.
| Compound Name | 2-[(2R,4R,11R)-1,11-dimethyl-18-azapentacyclo[9.6.1.02,4.05,10.012,17]octadeca-5,7,9,13-tetraen-4-yl]ethanol |
|---|---|
| PubChem CID | 155028467 |
| Molecular Formula | C21H27NO |
| Molecular Weight | 309.45 g/mol |
| Exact Mass | 309.21 |
| IUPAC Name | 2-[(2R,4R,11R)-1,11-dimethyl-18-azapentacyclo[9.6.1.02,4.05,10.012,17]octadeca-5,7,9,13-tetraen-4-yl]ethanol |
| SMILES | CC12N[C@@](C)(c3ccccc3[C@@]3(CCO)C[C@@H]13)C1C=CCCC12 |
| InChI | InChI=1S/C21H27NO/c1-19-14-7-3-4-8-15(14)20(2,22-19)18-13-21(18,11-12-23)17-10-6-5-9-16(17)19/h3,5-7,9-10,14-15,18,22-23H,4,8,11-13H2,1-2H3/t14?,15?,18-,19+,20?,21+/m0/s1 |
| InChIKey | JGBSWBXLICWNGU-DEYPKYCESA-N |
| XLogP | 3.50 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.45 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|