C21H22N2 — CID 155028479
2-[(1S,4R,11R)-1,11-dimethyl-18-azapentacyclo[9.6.1.02,4.05,10.012,17]octadeca-5,7,9,13,15-pentaen-4-yl]acetonitrile (PubChem CID 155028479) has the molecular formula C21H22N2 and a molecular weight of 302.42 g/mol. Its IUPAC name is 2-[(1S,4R,11R)-1,11-dimethyl-18-azapentacyclo[9.6.1.02,4.05,10.012,17]octadeca-5,7,9,13,15-pentaen-4-yl]acetonitrile.
| Compound Name | 2-[(1S,4R,11R)-1,11-dimethyl-18-azapentacyclo[9.6.1.02,4.05,10.012,17]octadeca-5,7,9,13,15-pentaen-4-yl]acetonitrile |
|---|---|
| PubChem CID | 155028479 |
| Molecular Formula | C21H22N2 |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.18 |
| IUPAC Name | 2-[(1S,4R,11R)-1,11-dimethyl-18-azapentacyclo[9.6.1.02,4.05,10.012,17]octadeca-5,7,9,13,15-pentaen-4-yl]acetonitrile |
| SMILES | C[C@@]12N[C@@](C)(c3ccccc3[C@@]3(CC#N)CC31)C1C=CC=CC12 |
| InChI | InChI=1S/C21H22N2/c1-19-14-7-3-4-8-15(14)20(2,23-19)18-13-21(18,11-12-22)17-10-6-5-9-16(17)19/h3-10,14-15,18,23H,11,13H2,1-2H3/t14?,15?,18?,19-,20+,21-/m1/s1 |
| InChIKey | RFOFLTGUIHGFMF-FLRBDLFJSA-N |
| XLogP | 3.81 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |